C13H20O2 — CID 575298
1',4,5-trimethylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene] (PubChem CID 575298) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 1',4,5-trimethylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene].
| Compound Name | 1',4,5-trimethylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene] |
|---|---|
| PubChem CID | 575298 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 1',4,5-trimethylspiro[1,3-dioxolane-2,5'-bicyclo[2.2.2]oct-2-ene] |
| SMILES | CC1OC2(CC3(C)C=CC2CC3)OC1C |
| InChI | InChI=1S/C13H20O2/c1-9-10(2)15-13(14-9)8-12(3)6-4-11(13)5-7-12/h4,6,9-11H,5,7-8H2,1-3H3 |
| InChIKey | WPZPDKJPBXRTFJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|