C22H33NO6 — CID 146167661
benzyl N-(2,2-diethoxyethyl)-N-(1,4-dioxaspiro[4.5]decan-8-yl)carbamate (PubChem CID 146167661) has the molecular formula C22H33NO6 and a molecular weight of 407.51 g/mol. Its IUPAC name is benzyl N-(2,2-diethoxyethyl)-N-(1,4-dioxaspiro[4.5]decan-8-yl)carbamate.
| Compound Name | benzyl N-(2,2-diethoxyethyl)-N-(1,4-dioxaspiro[4.5]decan-8-yl)carbamate |
|---|---|
| PubChem CID | 146167661 |
| Molecular Formula | C22H33NO6 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | benzyl N-(2,2-diethoxyethyl)-N-(1,4-dioxaspiro[4.5]decan-8-yl)carbamate |
| SMILES | CCOC(CN(C(=O)OCc1ccccc1)C1CCC2(CC1)OCCO2)OCC |
| InChI | InChI=1S/C22H33NO6/c1-3-25-20(26-4-2)16-23(21(24)27-17-18-8-6-5-7-9-18)19-10-12-22(13-11-19)28-14-15-29-22/h5-9,19-20H,3-4,10-17H2,1-2H3 |
| InChIKey | QRWBESXASSVHFZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|