C19H19N3OS — CID 146170668
2-amino-7,7-dimethyl-4-[(4-methylanilino)methylidene]-5-oxo-6H-1-benzothiophene-3-carbonitrile (PubChem CID 146170668) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-amino-7,7-dimethyl-4-[(4-methylanilino)methylidene]-5-oxo-6H-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-amino-7,7-dimethyl-4-[(4-methylanilino)methylidene]-5-oxo-6H-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 146170668 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-amino-7,7-dimethyl-4-[(4-methylanilino)methylidene]-5-oxo-6H-1-benzothiophene-3-carbonitrile |
| SMILES | Cc1ccc(NC=C2C(=O)CC(C)(C)c3sc(N)c(C#N)c32)cc1 |
| InChI | InChI=1S/C19H19N3OS/c1-11-4-6-12(7-5-11)22-10-14-15(23)8-19(2,3)17-16(14)13(9-20)18(21)24-17/h4-7,10,22H,8,21H2,1-3H3 |
| InChIKey | TWZRUFVIDKZYJW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|