C18H16ClN3OS — CID 146170669
2-amino-4-[(4-chloroanilino)methylidene]-7,7-dimethyl-5-oxo-6H-1-benzothiophene-3-carbonitrile (PubChem CID 146170669) has the molecular formula C18H16ClN3OS and a molecular weight of 357.87 g/mol. Its IUPAC name is 2-amino-4-[(4-chloroanilino)methylidene]-7,7-dimethyl-5-oxo-6H-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-amino-4-[(4-chloroanilino)methylidene]-7,7-dimethyl-5-oxo-6H-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 146170669 |
| Molecular Formula | C18H16ClN3OS |
| Molecular Weight | 357.87 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-amino-4-[(4-chloroanilino)methylidene]-7,7-dimethyl-5-oxo-6H-1-benzothiophene-3-carbonitrile |
| SMILES | CC1(C)CC(=O)C(=CNc2ccc(Cl)cc2)c2c1sc(N)c2C#N |
| InChI | InChI=1S/C18H16ClN3OS/c1-18(2)7-14(23)13(9-22-11-5-3-10(19)4-6-11)15-12(8-20)17(21)24-16(15)18/h3-6,9,22H,7,21H2,1-2H3 |
| InChIKey | BMQZELBMMCFWHL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.87 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|