C19H20O6S — CID 146174872
benzyl [(2R,3R)-2-(hydroxymethyl)-3-methyl-3,4-dihydro-2H-chromen-4-yl]sulfonylformate (PubChem CID 146174872) has the molecular formula C19H20O6S and a molecular weight of 376.43 g/mol. Its IUPAC name is benzyl [(2R,3R)-2-(hydroxymethyl)-3-methyl-3,4-dihydro-2H-chromen-4-yl]sulfonylformate.
| Compound Name | benzyl [(2R,3R)-2-(hydroxymethyl)-3-methyl-3,4-dihydro-2H-chromen-4-yl]sulfonylformate |
|---|---|
| PubChem CID | 146174872 |
| Molecular Formula | C19H20O6S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | benzyl [(2R,3R)-2-(hydroxymethyl)-3-methyl-3,4-dihydro-2H-chromen-4-yl]sulfonylformate |
| SMILES | C[C@H]1C(S(=O)(=O)C(=O)OCc2ccccc2)c2ccccc2O[C@H]1CO |
| InChI | InChI=1S/C19H20O6S/c1-13-17(11-20)25-16-10-6-5-9-15(16)18(13)26(22,23)19(21)24-12-14-7-3-2-4-8-14/h2-10,13,17-18,20H,11-12H2,1H3/t13-,17+,18?/m1/s1 |
| InChIKey | GLWSWHCJBWGPHI-GTDUKUAFSA-N |
| XLogP | 2.87 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|