C22H23N3O6S — CID 137305188
benzyl [(2R,3R)-2-methyl-3-[methyl-(5-oxo-4H-1,2,4-oxadiazol-3-yl)amino]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylformate (PubChem CID 137305188) has the molecular formula C22H23N3O6S and a molecular weight of 457.51 g/mol. Its IUPAC name is benzyl [(2R,3R)-2-methyl-3-[methyl-(5-oxo-4H-1,2,4-oxadiazol-3-yl)amino]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylformate.
| Compound Name | benzyl [(2R,3R)-2-methyl-3-[methyl-(5-oxo-4H-1,2,4-oxadiazol-3-yl)amino]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylformate |
|---|---|
| PubChem CID | 137305188 |
| Molecular Formula | C22H23N3O6S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | benzyl [(2R,3R)-2-methyl-3-[methyl-(5-oxo-4H-1,2,4-oxadiazol-3-yl)amino]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylformate |
| SMILES | C[C@H]1C(S(=O)(=O)C(=O)OCc2ccccc2)c2ccccc2C[C@H]1N(C)c1noc(=O)[nH]1 |
| InChI | InChI=1S/C22H23N3O6S/c1-14-18(25(2)20-23-21(26)31-24-20)12-16-10-6-7-11-17(16)19(14)32(28,29)22(27)30-13-15-8-4-3-5-9-15/h3-11,14,18-19H,12-13H2,1-2H3,(H,23,24,26)/t14-,18-,19?/m1/s1 |
| InChIKey | WVQKIFCHZRAOAA-QSFPRURJSA-N |
| XLogP | 2.85 |
| TPSA | 122.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|