C23H24N2O4S — CID 134450791
benzyl [(3S)-3-[(1-methylimidazol-2-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylformate (PubChem CID 134450791) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is benzyl [(3S)-3-[(1-methylimidazol-2-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylformate.
| Compound Name | benzyl [(3S)-3-[(1-methylimidazol-2-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylformate |
|---|---|
| PubChem CID | 134450791 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | benzyl [(3S)-3-[(1-methylimidazol-2-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylformate |
| SMILES | Cn1ccnc1C[C@@H]1Cc2ccccc2C(S(=O)(=O)C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C23H24N2O4S/c1-25-12-11-24-22(25)15-18-13-19-9-5-6-10-20(19)21(14-18)30(27,28)23(26)29-16-17-7-3-2-4-8-17/h2-12,18,21H,13-16H2,1H3/t18-,21?/m1/s1 |
| InChIKey | QTQVXXOLJIQAAR-ITUIMRKVSA-N |
| XLogP | 4.02 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|