C21H21N3O4S — CID 134450693
benzyl [3-(imidazol-1-ylmethyl)-3,4-dihydro-2H-quinolin-1-yl]sulfonylformate (PubChem CID 134450693) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is benzyl [3-(imidazol-1-ylmethyl)-3,4-dihydro-2H-quinolin-1-yl]sulfonylformate.
| Compound Name | benzyl [3-(imidazol-1-ylmethyl)-3,4-dihydro-2H-quinolin-1-yl]sulfonylformate |
|---|---|
| PubChem CID | 134450693 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | benzyl [3-(imidazol-1-ylmethyl)-3,4-dihydro-2H-quinolin-1-yl]sulfonylformate |
| SMILES | O=C(OCc1ccccc1)S(=O)(=O)N1CC(Cn2ccnc2)Cc2ccccc21 |
| InChI | InChI=1S/C21H21N3O4S/c25-21(28-15-17-6-2-1-3-7-17)29(26,27)24-14-18(13-23-11-10-22-16-23)12-19-8-4-5-9-20(19)24/h1-11,16,18H,12-15H2 |
| InChIKey | DIRMHTJKZQJEOV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|