About benzyl [(3R)-3-acetamido-3,4-dihydro-2H-quinolin-1-yl]sulfonylformate
benzyl [(3R)-3-acetamido-3,4-dihydro-2H-quinolin-1-yl]sulfonylformate (PubChem CID 134265889) has the molecular formula C19H20N2O5S
and a molecular weight of 388.45 g/mol. Its IUPAC name is benzyl [(3R)-3-acetamido-3,4-dihydro-2H-quinolin-1-yl]sulfonylformate.
Molecular Properties
| Compound Name | benzyl [(3R)-3-acetamido-3,4-dihydro-2H-quinolin-1-yl]sulfonylformate |
| PubChem CID | 134265889 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | benzyl [(3R)-3-acetamido-3,4-dihydro-2H-quinolin-1-yl]sulfonylformate |
| SMILES | CC(=O)N[C@@H]1Cc2ccccc2N(S(=O)(=O)C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C19H20N2O5S/c1-14(22)20-17-11-16-9-5-6-10-18(16)21(12-17)27(24,25)19(23)26-13-15-7-3-2-4-8-15/h2-10,17H,11-13H2,1H3,(H,20,22)/t17-/m1/s1 |
| InChIKey | DHBOHANECAJINS-QGZVFWFLSA-N |
| XLogP | 2.22 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze benzyl [(3R)-3-acetamido-3,4-dihydro-2H-quinolin-1-yl]sulfonylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl [(3R)-3-acetamido-3,4-dihydro-2H-quinolin-1-yl]sulfonylformate?
The IUPAC name of benzyl [(3R)-3-acetamido-3,4-dihydro-2H-quinolin-1-yl]sulfonylformate (CID 134265889) is benzyl [(3R)-3-acetamido-3,4-dihydro-2H-quinolin-1-yl]sulfonylformate.
What is the SMILES notation for benzyl [(3R)-3-acetamido-3,4-dihydro-2H-quinolin-1-yl]sulfonylformate?
The canonical SMILES for benzyl [(3R)-3-acetamido-3,4-dihydro-2H-quinolin-1-yl]sulfonylformate is CC(=O)N[C@@H]1Cc2ccccc2N(S(=O)(=O)C(=O)OCc2ccccc2)C1.
What is the InChIKey of benzyl [(3R)-3-acetamido-3,4-dihydro-2H-quinolin-1-yl]sulfonylformate?
The InChIKey is DHBOHANECAJINS-QGZVFWFLSA-N. The full InChI is InChI=1S/C19H20N2O5S/c1-14(22)20-17-11-16-9-5-6-10-18(16)21(12-17)27(24,25)19(23)26-13-15-7-3-2-4-8-15/h2-10,17H,11-13H2,1H3,(H,20,22)/t17-/m1/s1.
What are the key properties of benzyl [(3R)-3-acetamido-3,4-dihydro-2H-quinolin-1-yl]sulfonylformate?
benzyl [(3R)-3-acetamido-3,4-dihydro-2H-quinolin-1-yl]sulfonylformate has a molecular weight of 388.45 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl [(3R)-3-acetamido-3,4-dihydro-2H-quinolin-1-yl]sulfonylformate is sourced from PubChem (CID 134265889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).