C21H22N2O5S — CID 134265864
benzyl [(2R)-3-(acetamidomethyl)-2-methyl-2H-quinolin-1-yl]sulfonylformate (PubChem CID 134265864) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is benzyl [(2R)-3-(acetamidomethyl)-2-methyl-2H-quinolin-1-yl]sulfonylformate.
| Compound Name | benzyl [(2R)-3-(acetamidomethyl)-2-methyl-2H-quinolin-1-yl]sulfonylformate |
|---|---|
| PubChem CID | 134265864 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | benzyl [(2R)-3-(acetamidomethyl)-2-methyl-2H-quinolin-1-yl]sulfonylformate |
| SMILES | CC(=O)NCC1=Cc2ccccc2N(S(=O)(=O)C(=O)OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C21H22N2O5S/c1-15-19(13-22-16(2)24)12-18-10-6-7-11-20(18)23(15)29(26,27)21(25)28-14-17-8-4-3-5-9-17/h3-12,15H,13-14H2,1-2H3,(H,22,24)/t15-/m1/s1 |
| InChIKey | QCJDKENCVIKHOC-OAHLLOKOSA-N |
| XLogP | 3.08 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|