C18H15N3O7S — CID 134450672
benzyl [(2R)-2-(3-oxo-1,2,4-oxadiazol-5-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonylformate (PubChem CID 134450672) has the molecular formula C18H15N3O7S and a molecular weight of 417.40 g/mol. Its IUPAC name is benzyl [(2R)-2-(3-oxo-1,2,4-oxadiazol-5-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonylformate.
| Compound Name | benzyl [(2R)-2-(3-oxo-1,2,4-oxadiazol-5-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonylformate |
|---|---|
| PubChem CID | 134450672 |
| Molecular Formula | C18H15N3O7S |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | benzyl [(2R)-2-(3-oxo-1,2,4-oxadiazol-5-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonylformate |
| SMILES | O=C(OCc1ccccc1)S(=O)(=O)N1C[C@H](c2nc(=O)[nH]o2)Oc2ccccc21 |
| InChI | InChI=1S/C18H15N3O7S/c22-17-19-16(28-20-17)15-10-21(13-8-4-5-9-14(13)27-15)29(24,25)18(23)26-11-12-6-2-1-3-7-12/h1-9,15H,10-11H2,(H,20,22)/t15-/m1/s1 |
| InChIKey | GFKOKRGROVCEHF-OAHLLOKOSA-N |
| XLogP | 1.97 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|