C20H19N3O7S — CID 134450695
benzyl [(2S,3R)-3-methyl-2-[(2-oxo-3H-1,3,4-oxadiazol-5-yl)methyl]-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonylformate (PubChem CID 134450695) has the molecular formula C20H19N3O7S and a molecular weight of 445.45 g/mol. Its IUPAC name is benzyl [(2S,3R)-3-methyl-2-[(2-oxo-3H-1,3,4-oxadiazol-5-yl)methyl]-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonylformate.
| Compound Name | benzyl [(2S,3R)-3-methyl-2-[(2-oxo-3H-1,3,4-oxadiazol-5-yl)methyl]-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonylformate |
|---|---|
| PubChem CID | 134450695 |
| Molecular Formula | C20H19N3O7S |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | benzyl [(2S,3R)-3-methyl-2-[(2-oxo-3H-1,3,4-oxadiazol-5-yl)methyl]-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonylformate |
| SMILES | C[C@@H]1[C@H](Cc2n[nH]c(=O)o2)Oc2ccccc2N1S(=O)(=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H19N3O7S/c1-13-17(11-18-21-22-19(24)30-18)29-16-10-6-5-9-15(16)23(13)31(26,27)20(25)28-12-14-7-3-2-4-8-14/h2-10,13,17H,11-12H2,1H3,(H,22,24)/t13-,17+/m1/s1 |
| InChIKey | DQNIGZVREOBIIW-DYVFJYSZSA-N |
| XLogP | 2.23 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|