C23H27NO6S — CID 134265868
2,2-dimethyl-3-[(2R,3S)-2-methyl-1-phenylmethoxycarbonylsulfonyl-3,4-dihydro-2H-quinolin-3-yl]propanoic acid (PubChem CID 134265868) has the molecular formula C23H27NO6S and a molecular weight of 445.54 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(2R,3S)-2-methyl-1-phenylmethoxycarbonylsulfonyl-3,4-dihydro-2H-quinolin-3-yl]propanoic acid.
| Compound Name | 2,2-dimethyl-3-[(2R,3S)-2-methyl-1-phenylmethoxycarbonylsulfonyl-3,4-dihydro-2H-quinolin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 134265868 |
| Molecular Formula | C23H27NO6S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2,2-dimethyl-3-[(2R,3S)-2-methyl-1-phenylmethoxycarbonylsulfonyl-3,4-dihydro-2H-quinolin-3-yl]propanoic acid |
| SMILES | C[C@@H]1[C@H](CC(C)(C)C(=O)O)Cc2ccccc2N1S(=O)(=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H27NO6S/c1-16-19(14-23(2,3)21(25)26)13-18-11-7-8-12-20(18)24(16)31(28,29)22(27)30-15-17-9-5-4-6-10-17/h4-12,16,19H,13-15H2,1-3H3,(H,25,26)/t16-,19+/m1/s1 |
| InChIKey | RYLJVOHQQXSVBU-APWZRJJASA-N |
| XLogP | 4.22 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|