C19H14F3NO6S — CID 134265867
(2S)-1-phenylmethoxycarbonylsulfonyl-2-(trifluoromethyl)-2H-quinoline-3-carboxylic acid (PubChem CID 134265867) has the molecular formula C19H14F3NO6S and a molecular weight of 441.38 g/mol. Its IUPAC name is (2S)-1-phenylmethoxycarbonylsulfonyl-2-(trifluoromethyl)-2H-quinoline-3-carboxylic acid.
| Compound Name | (2S)-1-phenylmethoxycarbonylsulfonyl-2-(trifluoromethyl)-2H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 134265867 |
| Molecular Formula | C19H14F3NO6S |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | (2S)-1-phenylmethoxycarbonylsulfonyl-2-(trifluoromethyl)-2H-quinoline-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2ccccc2N(S(=O)(=O)C(=O)OCc2ccccc2)[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C19H14F3NO6S/c20-19(21,22)16-14(17(24)25)10-13-8-4-5-9-15(13)23(16)30(27,28)18(26)29-11-12-6-2-1-3-7-12/h1-10,16H,11H2,(H,24,25)/t16-/m0/s1 |
| InChIKey | CGCVZAFOVWWZIA-INIZCTEOSA-N |
| XLogP | 3.57 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|