C14H13F3O3 — CID 175955383
benzyl 6-(trifluoromethyl)-3,6-dihydro-2H-pyran-5-carboxylate (PubChem CID 175955383) has the molecular formula C14H13F3O3 and a molecular weight of 286.25 g/mol. Its IUPAC name is benzyl 6-(trifluoromethyl)-3,6-dihydro-2H-pyran-5-carboxylate.
| Compound Name | benzyl 6-(trifluoromethyl)-3,6-dihydro-2H-pyran-5-carboxylate |
|---|---|
| PubChem CID | 175955383 |
| Molecular Formula | C14H13F3O3 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | benzyl 6-(trifluoromethyl)-3,6-dihydro-2H-pyran-5-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1=CCCOC1C(F)(F)F |
| InChI | InChI=1S/C14H13F3O3/c15-14(16,17)12-11(7-4-8-19-12)13(18)20-9-10-5-2-1-3-6-10/h1-3,5-7,12H,4,8-9H2 |
| InChIKey | MWLSMZXXSRMJCR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |