C19H18N4O5S — CID 134450685
benzyl [(2S)-2-(triazol-1-ylmethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonylformate (PubChem CID 134450685) has the molecular formula C19H18N4O5S and a molecular weight of 414.44 g/mol. Its IUPAC name is benzyl [(2S)-2-(triazol-1-ylmethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonylformate.
| Compound Name | benzyl [(2S)-2-(triazol-1-ylmethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonylformate |
|---|---|
| PubChem CID | 134450685 |
| Molecular Formula | C19H18N4O5S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | benzyl [(2S)-2-(triazol-1-ylmethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonylformate |
| SMILES | O=C(OCc1ccccc1)S(=O)(=O)N1C[C@H](Cn2ccnn2)Oc2ccccc21 |
| InChI | InChI=1S/C19H18N4O5S/c24-19(27-14-15-6-2-1-3-7-15)29(25,26)23-13-16(12-22-11-10-20-21-22)28-18-9-5-4-8-17(18)23/h1-11,16H,12-14H2/t16-/m0/s1 |
| InChIKey | WLHPLCYTPXECSM-INIZCTEOSA-N |
| XLogP | 2.21 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|