C22H22N2O6S — CID 134450813
benzyl [(3R)-3-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)ethyl]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylformate (PubChem CID 134450813) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is benzyl [(3R)-3-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)ethyl]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylformate.
| Compound Name | benzyl [(3R)-3-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)ethyl]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylformate |
|---|---|
| PubChem CID | 134450813 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | benzyl [(3R)-3-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)ethyl]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylformate |
| SMILES | O=C(OCc1ccccc1)S(=O)(=O)C1C[C@H](CCc2n[nH]c(=O)o2)Cc2ccccc21 |
| InChI | InChI=1S/C22H22N2O6S/c25-21-24-23-20(30-21)11-10-16-12-17-8-4-5-9-18(17)19(13-16)31(27,28)22(26)29-14-15-6-2-1-3-7-15/h1-9,16,19H,10-14H2,(H,24,25)/t16-,19?/m1/s1 |
| InChIKey | JQXRVZMDVHGNSR-VTBWFHPJSA-N |
| XLogP | 3.35 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|