C24H28N2O6S — CID 134454718
benzyl [(3R)-3-[(2S,3Z)-3-(formylhydrazinylidene)-3-methoxy-2-methylpropyl]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylformate (PubChem CID 134454718) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is benzyl [(3R)-3-[(2S,3Z)-3-(formylhydrazinylidene)-3-methoxy-2-methylpropyl]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylformate.
| Compound Name | benzyl [(3R)-3-[(2S,3Z)-3-(formylhydrazinylidene)-3-methoxy-2-methylpropyl]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylformate |
|---|---|
| PubChem CID | 134454718 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | benzyl [(3R)-3-[(2S,3Z)-3-(formylhydrazinylidene)-3-methoxy-2-methylpropyl]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfonylformate |
| SMILES | CO/C(=N\NC=O)[C@@H](C)C[C@@H]1Cc2ccccc2C(S(=O)(=O)C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C24H28N2O6S/c1-17(23(31-2)26-25-16-27)12-19-13-20-10-6-7-11-21(20)22(14-19)33(29,30)24(28)32-15-18-8-4-3-5-9-18/h3-11,16-17,19,22H,12-15H2,1-2H3,(H,25,27)/b26-23-/t17-,19+,22?/m0/s1 |
| InChIKey | QFMFQRAZCVXPLK-NCJRXOMSSA-N |
| XLogP | 3.77 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|