C35H46F6O2 — CID 14618033
1-[3,3,4,4,5,5-hexafluoro-2-(4-nonylphenoxy)cyclopenten-1-yl]oxy-4-nonylbenzene (PubChem CID 14618033) has the molecular formula C35H46F6O2 and a molecular weight of 612.74 g/mol. Its IUPAC name is 1-[3,3,4,4,5,5-hexafluoro-2-(4-nonylphenoxy)cyclopenten-1-yl]oxy-4-nonylbenzene.
| Compound Name | 1-[3,3,4,4,5,5-hexafluoro-2-(4-nonylphenoxy)cyclopenten-1-yl]oxy-4-nonylbenzene |
|---|---|
| PubChem CID | 14618033 |
| Molecular Formula | C35H46F6O2 |
| Molecular Weight | 612.74 g/mol |
| Exact Mass | 612.34 |
| IUPAC Name | 1-[3,3,4,4,5,5-hexafluoro-2-(4-nonylphenoxy)cyclopenten-1-yl]oxy-4-nonylbenzene |
| SMILES | CCCCCCCCCc1ccc(OC2=C(Oc3ccc(CCCCCCCCC)cc3)C(F)(F)C(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C35H46F6O2/c1-3-5-7-9-11-13-15-17-27-19-23-29(24-20-27)42-31-32(34(38,39)35(40,41)33(31,36)37)43-30-25-21-28(22-26-30)18-16-14-12-10-8-6-4-2/h19-26H,3-18H2,1-2H3 |
| InChIKey | KRBGJFSTMVMWPX-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.74 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|