About 1-nonyl-4-(4-nonylphenoxy)benzene;2-silylethylsilane
1-nonyl-4-(4-nonylphenoxy)benzene;2-silylethylsilane (PubChem CID 173283482) has the molecular formula C32H56OSi2
and a molecular weight of 512.97 g/mol. Its IUPAC name is 1-nonyl-4-(4-nonylphenoxy)benzene;2-silylethylsilane.
Molecular Properties
| Compound Name | 1-nonyl-4-(4-nonylphenoxy)benzene;2-silylethylsilane |
| PubChem CID | 173283482 |
| Molecular Formula | C32H56OSi2 |
| Molecular Weight | 512.97 g/mol |
| Exact Mass | 512.39 |
| IUPAC Name | 1-nonyl-4-(4-nonylphenoxy)benzene;2-silylethylsilane |
| SMILES | CCCCCCCCCc1ccc(Oc2ccc(CCCCCCCCC)cc2)cc1.[SiH3]CC[SiH3] |
| InChI | InChI=1S/C30H46O.C2H10Si2/c1-3-5-7-9-11-13-15-17-27-19-23-29(24-20-27)31-30-25-21-28(22-26-30)18-16-14-12-10-8-6-4-2;3-1-2-4/h19-26H,3-18H2,1-2H3;1-2H2,3-4H3 |
| InChIKey | GGRPCMGTCHHOEE-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.97 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-nonyl-4-(4-nonylphenoxy)benzene;2-silylethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nonyl-4-(4-nonylphenoxy)benzene;2-silylethylsilane?
The IUPAC name of 1-nonyl-4-(4-nonylphenoxy)benzene;2-silylethylsilane (CID 173283482) is 1-nonyl-4-(4-nonylphenoxy)benzene;2-silylethylsilane.
What is the SMILES notation for 1-nonyl-4-(4-nonylphenoxy)benzene;2-silylethylsilane?
The canonical SMILES for 1-nonyl-4-(4-nonylphenoxy)benzene;2-silylethylsilane is CCCCCCCCCc1ccc(Oc2ccc(CCCCCCCCC)cc2)cc1.[SiH3]CC[SiH3].
What is the InChIKey of 1-nonyl-4-(4-nonylphenoxy)benzene;2-silylethylsilane?
The InChIKey is GGRPCMGTCHHOEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H46O.C2H10Si2/c1-3-5-7-9-11-13-15-17-27-19-23-29(24-20-27)31-30-25-21-28(22-26-30)18-16-14-12-10-8-6-4-2;3-1-2-4/h19-26H,3-18H2,1-2H3;1-2H2,3-4H3.
What are the key properties of 1-nonyl-4-(4-nonylphenoxy)benzene;2-silylethylsilane?
1-nonyl-4-(4-nonylphenoxy)benzene;2-silylethylsilane has a molecular weight of 512.97 g/mol, XLogP of 8.62, 19 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nonyl-4-(4-nonylphenoxy)benzene;2-silylethylsilane is sourced from PubChem (CID 173283482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).