C35H69NO5 — CID 146184390
nonyl 8-[2-hydroxyethyl-(8-octan-4-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 146184390) has the molecular formula C35H69NO5 and a molecular weight of 583.94 g/mol. Its IUPAC name is nonyl 8-[2-hydroxyethyl-(8-octan-4-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | nonyl 8-[2-hydroxyethyl-(8-octan-4-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 146184390 |
| Molecular Formula | C35H69NO5 |
| Molecular Weight | 583.94 g/mol |
| Exact Mass | 583.52 |
| IUPAC Name | nonyl 8-[2-hydroxyethyl-(8-octan-4-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCO)CCCCCCCC(=O)OC(CCC)CCCC |
| InChI | InChI=1S/C35H69NO5/c1-4-7-9-10-11-18-23-32-40-34(38)26-19-14-12-16-21-28-36(30-31-37)29-22-17-13-15-20-27-35(39)41-33(24-6-3)25-8-5-2/h33,37H,4-32H2,1-3H3 |
| InChIKey | RCXBZWYAXHOFFD-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.94 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|