C39H59N5O4 — CID 146188438
[(2S,3S,4E,6R)-3-methyl-12-oxo-2-[(2E,4E)-6-(2-pyrrolidin-1-ylpyrimidin-4-yl)hepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-cycloheptylpiperazine-1-carboxylate (PubChem CID 146188438) has the molecular formula C39H59N5O4 and a molecular weight of 661.93 g/mol. Its IUPAC name is [(2S,3S,4E,6R)-3-methyl-12-oxo-2-[(2E,4E)-6-(2-pyrrolidin-1-ylpyrimidin-4-yl)hepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-cycloheptylpiperazine-1-carboxylate.
| Compound Name | [(2S,3S,4E,6R)-3-methyl-12-oxo-2-[(2E,4E)-6-(2-pyrrolidin-1-ylpyrimidin-4-yl)hepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-cycloheptylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 146188438 |
| Molecular Formula | C39H59N5O4 |
| Molecular Weight | 661.93 g/mol |
| Exact Mass | 661.46 |
| IUPAC Name | [(2S,3S,4E,6R)-3-methyl-12-oxo-2-[(2E,4E)-6-(2-pyrrolidin-1-ylpyrimidin-4-yl)hepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-cycloheptylpiperazine-1-carboxylate |
| SMILES | C/C(=C\C=C\C(C)c1ccnc(N2CCCC2)n1)[C@H]1OC(=O)CCCCC[C@@H](OC(=O)N2CCN(C3CCCCCC3)CC2)/C=C/[C@@H]1C |
| InChI | InChI=1S/C39H59N5O4/c1-30(35-22-23-40-38(41-35)43-24-11-12-25-43)14-13-15-31(2)37-32(3)20-21-34(18-9-6-10-19-36(45)48-37)47-39(46)44-28-26-42(27-29-44)33-16-7-4-5-8-17-33/h13-15,20-23,30,32-34,37H,4-12,16-19,24-29H2,1-3H3/b14-13+,21-20+,31-15+/t30?,32-,34+,37+/m0/s1 |
| InChIKey | VSSBNPTYGBQUQL-DETRYFEHSA-N |
| XLogP | 7.60 |
| TPSA | 88.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.93 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|