C37H55N3O5 — CID 161341069
[(2S,3S,4E,6S,7R,10R)-7-hydroxy-3,7,10-trimethyl-12-oxo-2-[(2E,4E,6R)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-cyclohexylpiperazine-1-carboxylate (PubChem CID 161341069) has the molecular formula C37H55N3O5 and a molecular weight of 621.86 g/mol. Its IUPAC name is [(2S,3S,4E,6S,7R,10R)-7-hydroxy-3,7,10-trimethyl-12-oxo-2-[(2E,4E,6R)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-cyclohexylpiperazine-1-carboxylate.
| Compound Name | [(2S,3S,4E,6S,7R,10R)-7-hydroxy-3,7,10-trimethyl-12-oxo-2-[(2E,4E,6R)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-cyclohexylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 161341069 |
| Molecular Formula | C37H55N3O5 |
| Molecular Weight | 621.86 g/mol |
| Exact Mass | 621.41 |
| IUPAC Name | [(2S,3S,4E,6S,7R,10R)-7-hydroxy-3,7,10-trimethyl-12-oxo-2-[(2E,4E,6R)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-cyclohexylpiperazine-1-carboxylate |
| SMILES | C/C(=C\C=C\[C@@H](C)c1ccccn1)[C@H]1OC(=O)C[C@H](C)CC[C@@](C)(O)[C@@H](OC(=O)N2CCN(C3CCCCC3)CC2)/C=C/[C@@H]1C |
| InChI | InChI=1S/C37H55N3O5/c1-27-19-20-37(5,43)33(44-36(42)40-24-22-39(23-25-40)31-14-7-6-8-15-31)18-17-30(4)35(45-34(41)26-27)29(3)13-11-12-28(2)32-16-9-10-21-38-32/h9-13,16-18,21,27-28,30-31,33,35,43H,6-8,14-15,19-20,22-26H2,1-5H3/b12-11+,18-17+,29-13+/t27-,28-,30+,33+,35-,37-/m1/s1 |
| InChIKey | WWPPOWGDWAUABF-VJEKYHSCSA-N |
| XLogP | 6.82 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.86 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|