C35H51N3O5 — CID 158877639
[(2S,3S,4E,6S,7R,10R)-7-hydroxy-3,7,10-trimethyl-12-oxo-2-[(2E,4E,6R)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-cyclobutylpiperazine-1-carboxylate (PubChem CID 158877639) has the molecular formula C35H51N3O5 and a molecular weight of 593.81 g/mol. Its IUPAC name is [(2S,3S,4E,6S,7R,10R)-7-hydroxy-3,7,10-trimethyl-12-oxo-2-[(2E,4E,6R)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-cyclobutylpiperazine-1-carboxylate.
| Compound Name | [(2S,3S,4E,6S,7R,10R)-7-hydroxy-3,7,10-trimethyl-12-oxo-2-[(2E,4E,6R)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-cyclobutylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 158877639 |
| Molecular Formula | C35H51N3O5 |
| Molecular Weight | 593.81 g/mol |
| Exact Mass | 593.38 |
| IUPAC Name | [(2S,3S,4E,6S,7R,10R)-7-hydroxy-3,7,10-trimethyl-12-oxo-2-[(2E,4E,6R)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-cyclobutylpiperazine-1-carboxylate |
| SMILES | C/C(=C\C=C\[C@@H](C)c1ccccn1)[C@H]1OC(=O)C[C@H](C)CC[C@@](C)(O)[C@@H](OC(=O)N2CCN(C3CCC3)CC2)/C=C/[C@@H]1C |
| InChI | InChI=1S/C35H51N3O5/c1-25-17-18-35(5,41)31(42-34(40)38-22-20-37(21-23-38)29-12-9-13-29)16-15-28(4)33(43-32(39)24-25)27(3)11-8-10-26(2)30-14-6-7-19-36-30/h6-8,10-11,14-16,19,25-26,28-29,31,33,41H,9,12-13,17-18,20-24H2,1-5H3/b10-8+,16-15+,27-11+/t25-,26-,28+,31+,33-,35-/m1/s1 |
| InChIKey | PXEJIKXMAJGBEA-KSEFFEKASA-N |
| XLogP | 6.04 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.81 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|