C33H49N3O6 — CID 146188380
[(2S,3S,4E,6S,7R,10R)-7,10-dihydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E,6R)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-propan-2-ylpiperazine-1-carboxylate (PubChem CID 146188380) has the molecular formula C33H49N3O6 and a molecular weight of 583.77 g/mol. Its IUPAC name is [(2S,3S,4E,6S,7R,10R)-7,10-dihydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E,6R)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-propan-2-ylpiperazine-1-carboxylate.
| Compound Name | [(2S,3S,4E,6S,7R,10R)-7,10-dihydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E,6R)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-propan-2-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 146188380 |
| Molecular Formula | C33H49N3O6 |
| Molecular Weight | 583.77 g/mol |
| Exact Mass | 583.36 |
| IUPAC Name | [(2S,3S,4E,6S,7R,10R)-7,10-dihydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E,6R)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-propan-2-ylpiperazine-1-carboxylate |
| SMILES | C/C(=C\C=C\[C@@H](C)c1ccccn1)[C@H]1OC(=O)C[C@H](O)CC[C@@](C)(O)[C@@H](OC(=O)N2CCN(C(C)C)CC2)/C=C/[C@@H]1C |
| InChI | InChI=1S/C33H49N3O6/c1-23(2)35-18-20-36(21-19-35)32(39)41-29-14-13-26(5)31(42-30(38)22-27(37)15-16-33(29,6)40)25(4)11-9-10-24(3)28-12-7-8-17-34-28/h7-14,17,23-24,26-27,29,31,37,40H,15-16,18-22H2,1-6H3/b10-9+,14-13+,25-11+/t24-,26+,27-,29+,31-,33-/m1/s1 |
| InChIKey | KBRJEJQVVMBSHV-VCCMFPOXSA-N |
| XLogP | 4.62 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.77 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|