C33H49N3O5 — CID 146188396
[(2S,3S,4E,6R,7S,10R)-10-hydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E,6R)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-propan-2-ylpiperazine-1-carboxylate (PubChem CID 146188396) has the molecular formula C33H49N3O5 and a molecular weight of 567.77 g/mol. Its IUPAC name is [(2S,3S,4E,6R,7S,10R)-10-hydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E,6R)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-propan-2-ylpiperazine-1-carboxylate.
| Compound Name | [(2S,3S,4E,6R,7S,10R)-10-hydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E,6R)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-propan-2-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 146188396 |
| Molecular Formula | C33H49N3O5 |
| Molecular Weight | 567.77 g/mol |
| Exact Mass | 567.37 |
| IUPAC Name | [(2S,3S,4E,6R,7S,10R)-10-hydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E,6R)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-propan-2-ylpiperazine-1-carboxylate |
| SMILES | C/C(=C\C=C\[C@@H](C)c1ccccn1)[C@H]1OC(=O)C[C@H](O)CC[C@H](C)[C@@H](OC(=O)N2CCN(C(C)C)CC2)/C=C/[C@@H]1C |
| InChI | InChI=1S/C33H49N3O5/c1-23(2)35-18-20-36(21-19-35)33(39)40-30-16-14-27(6)32(41-31(38)22-28(37)15-13-25(30)4)26(5)11-9-10-24(3)29-12-7-8-17-34-29/h7-12,14,16-17,23-25,27-28,30,32,37H,13,15,18-22H2,1-6H3/b10-9+,16-14+,26-11+/t24-,25+,27+,28-,30+,32-/m1/s1 |
| InChIKey | PBFMMTQGPWCWBS-ZBFSWYNFSA-N |
| XLogP | 5.50 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.77 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|