C27H37NO5 — CID 155783673
[(2S,3S,4Z,6R,7R,10S)-10-hydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E,6S)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 155783673) has the molecular formula C27H37NO5 and a molecular weight of 455.60 g/mol. Its IUPAC name is [(2S,3S,4Z,6R,7R,10S)-10-hydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E,6S)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(2S,3S,4Z,6R,7R,10S)-10-hydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E,6S)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 155783673 |
| Molecular Formula | C27H37NO5 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | [(2S,3S,4Z,6R,7R,10S)-10-hydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E,6S)-6-pyridin-2-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1/C=C\[C@H](C)[C@@H](/C(C)=C/C=C/[C@H](C)c2ccccn2)OC(=O)C[C@@H](O)CC[C@H]1C |
| InChI | InChI=1S/C27H37NO5/c1-18(24-11-6-7-16-28-24)9-8-10-20(3)27-21(4)13-15-25(32-22(5)29)19(2)12-14-23(30)17-26(31)33-27/h6-11,13,15-16,18-19,21,23,25,27,30H,12,14,17H2,1-5H3/b9-8+,15-13-,20-10+/t18-,19+,21-,23-,25-,27+/m0/s1 |
| InChIKey | PRVNODHATAQWMP-YMEJFUDYSA-N |
| XLogP | 4.90 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|