C37H55N3O6 — CID 177306130
[(2S,3S,4Z,6S,7R,10R)-7,10-dihydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E)-6-pyridin-4-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-cycloheptylpiperazine-1-carboxylate (PubChem CID 177306130) has the molecular formula C37H55N3O6 and a molecular weight of 637.86 g/mol. Its IUPAC name is [(2S,3S,4Z,6S,7R,10R)-7,10-dihydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E)-6-pyridin-4-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-cycloheptylpiperazine-1-carboxylate.
| Compound Name | [(2S,3S,4Z,6S,7R,10R)-7,10-dihydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E)-6-pyridin-4-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-cycloheptylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 177306130 |
| Molecular Formula | C37H55N3O6 |
| Molecular Weight | 637.86 g/mol |
| Exact Mass | 637.41 |
| IUPAC Name | [(2S,3S,4Z,6S,7R,10R)-7,10-dihydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E)-6-pyridin-4-ylhepta-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] 4-cycloheptylpiperazine-1-carboxylate |
| SMILES | C/C(=C\C=C\C(C)c1ccncc1)[C@H]1OC(=O)C[C@H](O)CC[C@@](C)(O)[C@@H](OC(=O)N2CCN(C3CCCCCC3)CC2)/C=C\[C@@H]1C |
| InChI | InChI=1S/C37H55N3O6/c1-27(30-17-20-38-21-18-30)10-9-11-28(2)35-29(3)14-15-33(37(4,44)19-16-32(41)26-34(42)46-35)45-36(43)40-24-22-39(23-25-40)31-12-7-5-6-8-13-31/h9-11,14-15,17-18,20-21,27,29,31-33,35,41,44H,5-8,12-13,16,19,22-26H2,1-4H3/b10-9+,15-14-,28-11+/t27?,29-,32+,33-,35+,37+/m0/s1 |
| InChIKey | LRYJYIUPQUFKDO-YJIUXFAOSA-N |
| XLogP | 5.93 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.86 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|