C15H19NO — CID 146193865
7-(2-ethylphenyl)-2,3,4,5-tetrahydroazepine-1-carbaldehyde (PubChem CID 146193865) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 7-(2-ethylphenyl)-2,3,4,5-tetrahydroazepine-1-carbaldehyde.
| Compound Name | 7-(2-ethylphenyl)-2,3,4,5-tetrahydroazepine-1-carbaldehyde |
|---|---|
| PubChem CID | 146193865 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 7-(2-ethylphenyl)-2,3,4,5-tetrahydroazepine-1-carbaldehyde |
| SMILES | CCc1ccccc1C1=CCCCCN1C=O |
| InChI | InChI=1S/C15H19NO/c1-2-13-8-5-6-9-14(13)15-10-4-3-7-11-16(15)12-17/h5-6,8-10,12H,2-4,7,11H2,1H3 |
| InChIKey | NCXIMFFSFGIOKB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|