C14H16INO — CID 153451756
6-(2-ethylphenyl)-3-iodo-1-methyl-3,4-dihydropyridin-2-one (PubChem CID 153451756) has the molecular formula C14H16INO and a molecular weight of 341.19 g/mol. Its IUPAC name is 6-(2-ethylphenyl)-3-iodo-1-methyl-3,4-dihydropyridin-2-one.
| Compound Name | 6-(2-ethylphenyl)-3-iodo-1-methyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153451756 |
| Molecular Formula | C14H16INO |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 6-(2-ethylphenyl)-3-iodo-1-methyl-3,4-dihydropyridin-2-one |
| SMILES | CCc1ccccc1C1=CCC(I)C(=O)N1C |
| InChI | InChI=1S/C14H16INO/c1-3-10-6-4-5-7-11(10)13-9-8-12(15)14(17)16(13)2/h4-7,9,12H,3,8H2,1-2H3 |
| InChIKey | FQYITXAKAIOAKI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|