C20H22F3N5O3 — CID 146195233
(7S)-4,7,8-trimethyl-2-[[(3S,5S)-5-[(3,4,5-trifluorophenoxy)methyl]oxolan-3-yl]amino]-5,7-dihydropteridin-6-one (PubChem CID 146195233) has the molecular formula C20H22F3N5O3 and a molecular weight of 437.42 g/mol. Its IUPAC name is (7S)-4,7,8-trimethyl-2-[[(3S,5S)-5-[(3,4,5-trifluorophenoxy)methyl]oxolan-3-yl]amino]-5,7-dihydropteridin-6-one.
| Compound Name | (7S)-4,7,8-trimethyl-2-[[(3S,5S)-5-[(3,4,5-trifluorophenoxy)methyl]oxolan-3-yl]amino]-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 146195233 |
| Molecular Formula | C20H22F3N5O3 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | (7S)-4,7,8-trimethyl-2-[[(3S,5S)-5-[(3,4,5-trifluorophenoxy)methyl]oxolan-3-yl]amino]-5,7-dihydropteridin-6-one |
| SMILES | Cc1nc(N[C@@H]2CO[C@H](COc3cc(F)c(F)c(F)c3)C2)nc2c1NC(=O)[C@H](C)N2C |
| InChI | InChI=1S/C20H22F3N5O3/c1-9-17-18(28(3)10(2)19(29)26-17)27-20(24-9)25-11-4-13(30-7-11)8-31-12-5-14(21)16(23)15(22)6-12/h5-6,10-11,13H,4,7-8H2,1-3H3,(H,26,29)(H,24,25,27)/t10-,11-,13-/m0/s1 |
| InChIKey | SASBRMLVCUCJHM-GVXVVHGQSA-N |
| XLogP | 2.63 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|