C20H22F3N5O2 — CID 146202997
(7S)-4,7,8-trimethyl-2-[[3-(3,4,5-trifluorophenoxy)cyclobutyl]methylamino]-5,7-dihydropteridin-6-one (PubChem CID 146202997) has the molecular formula C20H22F3N5O2 and a molecular weight of 421.42 g/mol. Its IUPAC name is (7S)-4,7,8-trimethyl-2-[[3-(3,4,5-trifluorophenoxy)cyclobutyl]methylamino]-5,7-dihydropteridin-6-one.
| Compound Name | (7S)-4,7,8-trimethyl-2-[[3-(3,4,5-trifluorophenoxy)cyclobutyl]methylamino]-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 146202997 |
| Molecular Formula | C20H22F3N5O2 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | (7S)-4,7,8-trimethyl-2-[[3-(3,4,5-trifluorophenoxy)cyclobutyl]methylamino]-5,7-dihydropteridin-6-one |
| SMILES | Cc1nc(NCC2CC(Oc3cc(F)c(F)c(F)c3)C2)nc2c1NC(=O)[C@H](C)N2C |
| InChI | InChI=1S/C20H22F3N5O2/c1-9-17-18(28(3)10(2)19(29)26-17)27-20(25-9)24-8-11-4-12(5-11)30-13-6-14(21)16(23)15(22)7-13/h6-7,10-12H,4-5,8H2,1-3H3,(H,26,29)(H,24,25,27)/t10-,11?,12?/m0/s1 |
| InChIKey | HFSQBOHUYIPKBD-UNXYVOJBSA-N |
| XLogP | 3.25 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|