About 2-chloro-1,1-dimethoxynonane
2-chloro-1,1-dimethoxynonane (PubChem CID 14619929) has the molecular formula C11H23ClO2
and a molecular weight of 222.76 g/mol. Its IUPAC name is 2-chloro-1,1-dimethoxynonane.
Molecular Properties
| Compound Name | 2-chloro-1,1-dimethoxynonane |
| PubChem CID | 14619929 |
| Molecular Formula | C11H23ClO2 |
| Molecular Weight | 222.76 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-chloro-1,1-dimethoxynonane |
| SMILES | CCCCCCCC(Cl)C(OC)OC |
| InChI | InChI=1S/C11H23ClO2/c1-4-5-6-7-8-9-10(12)11(13-2)14-3/h10-11H,4-9H2,1-3H3 |
| InChIKey | ZYYMNKDTWZIKHK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.76 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,1-dimethoxynonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,1-dimethoxynonane?
The IUPAC name of 2-chloro-1,1-dimethoxynonane (CID 14619929) is 2-chloro-1,1-dimethoxynonane.
What is the SMILES notation for 2-chloro-1,1-dimethoxynonane?
The canonical SMILES for 2-chloro-1,1-dimethoxynonane is CCCCCCCC(Cl)C(OC)OC.
What is the InChIKey of 2-chloro-1,1-dimethoxynonane?
The InChIKey is ZYYMNKDTWZIKHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23ClO2/c1-4-5-6-7-8-9-10(12)11(13-2)14-3/h10-11H,4-9H2,1-3H3.
What are the key properties of 2-chloro-1,1-dimethoxynonane?
2-chloro-1,1-dimethoxynonane has a molecular weight of 222.76 g/mol, XLogP of 3.57, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,1-dimethoxynonane is sourced from PubChem (CID 14619929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).