C21H22ClFN8O — CID 146200473
3-[5-chloro-2-(tetrazol-1-yl)phenyl]-N'-ethyl-N-(4-fluoroazetidin-2-yl)-7-hydroxy-5,6-dihydrocyclopenta[b]pyridine-7-carboximidamide (PubChem CID 146200473) has the molecular formula C21H22ClFN8O and a molecular weight of 456.91 g/mol. Its IUPAC name is 3-[5-chloro-2-(tetrazol-1-yl)phenyl]-N'-ethyl-N-(4-fluoroazetidin-2-yl)-7-hydroxy-5,6-dihydrocyclopenta[b]pyridine-7-carboximidamide.
| Compound Name | 3-[5-chloro-2-(tetrazol-1-yl)phenyl]-N'-ethyl-N-(4-fluoroazetidin-2-yl)-7-hydroxy-5,6-dihydrocyclopenta[b]pyridine-7-carboximidamide |
|---|---|
| PubChem CID | 146200473 |
| Molecular Formula | C21H22ClFN8O |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 3-[5-chloro-2-(tetrazol-1-yl)phenyl]-N'-ethyl-N-(4-fluoroazetidin-2-yl)-7-hydroxy-5,6-dihydrocyclopenta[b]pyridine-7-carboximidamide |
| SMILES | CC/N=C(\NC1CC(F)N1)C1(O)CCc2cc(-c3cc(Cl)ccc3-n3cnnn3)cnc21 |
| InChI | InChI=1S/C21H22ClFN8O/c1-2-24-20(28-18-9-17(23)27-18)21(32)6-5-12-7-13(10-25-19(12)21)15-8-14(22)3-4-16(15)31-11-26-29-30-31/h3-4,7-8,10-11,17-18,27,32H,2,5-6,9H2,1H3,(H,24,28) |
| InChIKey | XYTJEPPPLZDSIO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|