C27H28FN5O5 — CID 146205227
1-[1'-[2-[(3R)-3-cyclopropyl-7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-oxoethyl]-2',5'-dioxospiro[2,3-dihydroindene-1,4'-imidazolidine]-5-yl]-3-methylurea (PubChem CID 146205227) has the molecular formula C27H28FN5O5 and a molecular weight of 521.55 g/mol. Its IUPAC name is 1-[1'-[2-[(3R)-3-cyclopropyl-7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-oxoethyl]-2',5'-dioxospiro[2,3-dihydroindene-1,4'-imidazolidine]-5-yl]-3-methylurea.
| Compound Name | 1-[1'-[2-[(3R)-3-cyclopropyl-7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-oxoethyl]-2',5'-dioxospiro[2,3-dihydroindene-1,4'-imidazolidine]-5-yl]-3-methylurea |
|---|---|
| PubChem CID | 146205227 |
| Molecular Formula | C27H28FN5O5 |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 1-[1'-[2-[(3R)-3-cyclopropyl-7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-oxoethyl]-2',5'-dioxospiro[2,3-dihydroindene-1,4'-imidazolidine]-5-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc2c(c1)CCC21NC(=O)N(CC(=O)N2Cc3cc(F)ccc3OC[C@H]2C2CC2)C1=O |
| InChI | InChI=1S/C27H28FN5O5/c1-29-25(36)30-19-5-6-20-16(11-19)8-9-27(20)24(35)33(26(37)31-27)13-23(34)32-12-17-10-18(28)4-7-22(17)38-14-21(32)15-2-3-15/h4-7,10-11,15,21H,2-3,8-9,12-14H2,1H3,(H,31,37)(H2,29,30,36)/t21-,27?/m0/s1 |
| InChIKey | SZDFQTQSZKMHLZ-LWAJAQLZSA-N |
| XLogP | 2.47 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|