C28H30FN5O4 — CID 156672597
1-[(1R)-1'-[2-[(3S)-3-cyclopropyl-7-fluoro-1,3,4,5-tetrahydro-2-benzazepin-2-yl]-2-oxoethyl]-2',5'-dioxospiro[2,3-dihydroindene-1,4'-imidazolidine]-5-yl]-3-methylurea (PubChem CID 156672597) has the molecular formula C28H30FN5O4 and a molecular weight of 519.58 g/mol. Its IUPAC name is 1-[(1R)-1'-[2-[(3S)-3-cyclopropyl-7-fluoro-1,3,4,5-tetrahydro-2-benzazepin-2-yl]-2-oxoethyl]-2',5'-dioxospiro[2,3-dihydroindene-1,4'-imidazolidine]-5-yl]-3-methylurea.
| Compound Name | 1-[(1R)-1'-[2-[(3S)-3-cyclopropyl-7-fluoro-1,3,4,5-tetrahydro-2-benzazepin-2-yl]-2-oxoethyl]-2',5'-dioxospiro[2,3-dihydroindene-1,4'-imidazolidine]-5-yl]-3-methylurea |
|---|---|
| PubChem CID | 156672597 |
| Molecular Formula | C28H30FN5O4 |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 1-[(1R)-1'-[2-[(3S)-3-cyclopropyl-7-fluoro-1,3,4,5-tetrahydro-2-benzazepin-2-yl]-2-oxoethyl]-2',5'-dioxospiro[2,3-dihydroindene-1,4'-imidazolidine]-5-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc2c(c1)CC[C@@]21NC(=O)N(CC(=O)N2Cc3ccc(F)cc3CC[C@H]2C2CC2)C1=O |
| InChI | InChI=1S/C28H30FN5O4/c1-30-26(37)31-21-7-8-22-18(13-21)10-11-28(22)25(36)34(27(38)32-28)15-24(35)33-14-19-4-6-20(29)12-17(19)5-9-23(33)16-2-3-16/h4,6-8,12-13,16,23H,2-3,5,9-11,14-15H2,1H3,(H,32,38)(H2,30,31,37)/t23-,28+/m0/s1 |
| InChIKey | BGTFVPIWKNEMCX-NEKDWFFYSA-N |
| XLogP | 3.02 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|