C26H25F4N5O4 — CID 146204970
1-[1'-[2-[(3S)-7-fluoro-3-(trifluoromethyl)-1,3,4,5-tetrahydro-2-benzazepin-2-yl]-2-oxoethyl]-2',5'-dioxospiro[2,3-dihydroindene-1,4'-imidazolidine]-5-yl]-3-methylurea (PubChem CID 146204970) has the molecular formula C26H25F4N5O4 and a molecular weight of 547.51 g/mol. Its IUPAC name is 1-[1'-[2-[(3S)-7-fluoro-3-(trifluoromethyl)-1,3,4,5-tetrahydro-2-benzazepin-2-yl]-2-oxoethyl]-2',5'-dioxospiro[2,3-dihydroindene-1,4'-imidazolidine]-5-yl]-3-methylurea.
| Compound Name | 1-[1'-[2-[(3S)-7-fluoro-3-(trifluoromethyl)-1,3,4,5-tetrahydro-2-benzazepin-2-yl]-2-oxoethyl]-2',5'-dioxospiro[2,3-dihydroindene-1,4'-imidazolidine]-5-yl]-3-methylurea |
|---|---|
| PubChem CID | 146204970 |
| Molecular Formula | C26H25F4N5O4 |
| Molecular Weight | 547.51 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 1-[1'-[2-[(3S)-7-fluoro-3-(trifluoromethyl)-1,3,4,5-tetrahydro-2-benzazepin-2-yl]-2-oxoethyl]-2',5'-dioxospiro[2,3-dihydroindene-1,4'-imidazolidine]-5-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc2c(c1)CCC21NC(=O)N(CC(=O)N2Cc3ccc(F)cc3CC[C@H]2C(F)(F)F)C1=O |
| InChI | InChI=1S/C26H25F4N5O4/c1-31-23(38)32-18-5-6-19-15(11-18)8-9-25(19)22(37)35(24(39)33-25)13-21(36)34-12-16-2-4-17(27)10-14(16)3-7-20(34)26(28,29)30/h2,4-6,10-11,20H,3,7-9,12-13H2,1H3,(H,33,39)(H2,31,32,38)/t20-,25?/m0/s1 |
| InChIKey | AXPDMRMZTLGEFP-JINQPTGOSA-N |
| XLogP | 3.18 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|