C42H31N3 — CID 146209674
N'-benzyl-N-benzylidene-3-(3-cyanophenyl)-5-(1,2-dihydrophenanthren-9-yl)benzenecarboximidamide (PubChem CID 146209674) has the molecular formula C42H31N3 and a molecular weight of 577.73 g/mol. Its IUPAC name is N'-benzyl-N-benzylidene-3-(3-cyanophenyl)-5-(1,2-dihydrophenanthren-9-yl)benzenecarboximidamide.
| Compound Name | N'-benzyl-N-benzylidene-3-(3-cyanophenyl)-5-(1,2-dihydrophenanthren-9-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 146209674 |
| Molecular Formula | C42H31N3 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | N'-benzyl-N-benzylidene-3-(3-cyanophenyl)-5-(1,2-dihydrophenanthren-9-yl)benzenecarboximidamide |
| SMILES | N#Cc1cccc(-c2cc(C(=N/Cc3ccccc3)/N=C/c3ccccc3)cc(-c3cc4c(c5ccccc35)C=CCC4)c2)c1 |
| InChI | InChI=1S/C42H31N3/c43-27-32-16-11-18-33(22-32)35-23-36(41-26-34-17-7-8-19-38(34)39-20-9-10-21-40(39)41)25-37(24-35)42(44-28-30-12-3-1-4-13-30)45-29-31-14-5-2-6-15-31/h1-6,8-16,18-26,28H,7,17,29H2/b44-28+,45-42- |
| InChIKey | FIHSDCIWQTZVED-NGTMAOIYSA-N |
| XLogP | 10.07 |
| TPSA | 48.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|