C27H33N3O5S2 — CID 146210622
2-[4-[(5-ethenylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)sulfonyl]phenyl]-3-phenyl-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 146210622) has the molecular formula C27H33N3O5S2 and a molecular weight of 543.71 g/mol. Its IUPAC name is 2-[4-[(5-ethenylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)sulfonyl]phenyl]-3-phenyl-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 2-[4-[(5-ethenylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)sulfonyl]phenyl]-3-phenyl-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 146210622 |
| Molecular Formula | C27H33N3O5S2 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | 2-[4-[(5-ethenylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)sulfonyl]phenyl]-3-phenyl-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | C=CS(=O)(=O)N1CC2CCN(S(=O)(=O)c3ccc(C(Cc4ccccc4)C(=O)N4CCCC4)cc3)C2C1 |
| InChI | InChI=1S/C27H33N3O5S2/c1-2-36(32,33)29-19-23-14-17-30(26(23)20-29)37(34,35)24-12-10-22(11-13-24)25(18-21-8-4-3-5-9-21)27(31)28-15-6-7-16-28/h2-5,8-13,23,25-26H,1,6-7,14-20H2 |
| InChIKey | LQXMELUKHTZFOX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |