C14H16O3 — CID 146215650
[(1S,8R)-6-hydroxy-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] propanoate (PubChem CID 146215650) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is [(1S,8R)-6-hydroxy-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] propanoate.
| Compound Name | [(1S,8R)-6-hydroxy-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] propanoate |
|---|---|
| PubChem CID | 146215650 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | [(1S,8R)-6-hydroxy-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(O)c2c1[C@H]1CC[C@@H]2C1 |
| InChI | InChI=1S/C14H16O3/c1-2-12(16)17-11-6-5-10(15)13-8-3-4-9(7-8)14(11)13/h5-6,8-9,15H,2-4,7H2,1H3/t8-,9+/m1/s1 |
| InChIKey | VFRVGTZDMNKFLW-BDAKNGLRSA-N |
| XLogP | 3.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|