C18H21ClN4O2 — CID 146216143
7-[1-[4-(chloromethyl)phenyl]ethylamino]-1-propan-2-yl-4H-pyrimido[4,5-d][1,3]oxazin-2-one (PubChem CID 146216143) has the molecular formula C18H21ClN4O2 and a molecular weight of 360.85 g/mol. Its IUPAC name is 7-[1-[4-(chloromethyl)phenyl]ethylamino]-1-propan-2-yl-4H-pyrimido[4,5-d][1,3]oxazin-2-one.
| Compound Name | 7-[1-[4-(chloromethyl)phenyl]ethylamino]-1-propan-2-yl-4H-pyrimido[4,5-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 146216143 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 7-[1-[4-(chloromethyl)phenyl]ethylamino]-1-propan-2-yl-4H-pyrimido[4,5-d][1,3]oxazin-2-one |
| SMILES | CC(Nc1ncc2c(n1)N(C(C)C)C(=O)OC2)c1ccc(CCl)cc1 |
| InChI | InChI=1S/C18H21ClN4O2/c1-11(2)23-16-15(10-25-18(23)24)9-20-17(22-16)21-12(3)14-6-4-13(8-19)5-7-14/h4-7,9,11-12H,8,10H2,1-3H3,(H,20,21,22) |
| InChIKey | MNDRIZOEXZRGFW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|