C22H26BF2N6O3 — CID 140867267
CID 140867267 (PubChem CID 140867267) has the molecular formula C22H26BF2N6O3 and a molecular weight of 471.30 g/mol.
| Compound Name | CID 140867267 |
|---|---|
| PubChem CID | 140867267 |
| Molecular Formula | C22H26BF2N6O3 |
| Molecular Weight | 471.30 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | — |
| SMILES | C[C@H](Nc1ncc2c(n1)N(CC(F)F)C(=O)OC2)c1ccc(CN2CCN([B]C=O)CC2)cc1 |
| InChI | InChI=1S/C22H26BF2N6O3/c1-15(17-4-2-16(3-5-17)11-29-6-8-30(9-7-29)23-14-32)27-21-26-10-18-13-34-22(33)31(12-19(24)25)20(18)28-21/h2-5,10,14-15,19H,6-9,11-13H2,1H3,(H,26,27,28)/t15-/m0/s1 |
| InChIKey | CEWBFODXIVCASQ-HNNXBMFYSA-N |
| XLogP | 2.30 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|