C28H38BN6O5 — CID 140867290
CID 140867290 (PubChem CID 140867290) has the molecular formula C28H38BN6O5 and a molecular weight of 549.46 g/mol.
| Compound Name | CID 140867290 |
|---|---|
| PubChem CID | 140867290 |
| Molecular Formula | C28H38BN6O5 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | — |
| SMILES | C[C@H](Nc1ncc2c(n1)N([C@H](C)COC1CCCCO1)C(=O)OC2)c1ccc(CN2CCN([B]C=O)CC2)cc1 |
| InChI | InChI=1S/C28H38BN6O5/c1-20(17-39-25-5-3-4-14-38-25)35-26-24(18-40-28(35)37)15-30-27(32-26)31-21(2)23-8-6-22(7-9-23)16-33-10-12-34(13-11-33)29-19-36/h6-9,15,19-21,25H,3-5,10-14,16-18H2,1-2H3,(H,30,31,32)/t20-,21+,25?/m1/s1 |
| InChIKey | SCIHOFNDKDYRCF-GJAAFAAWSA-N |
| XLogP | 2.96 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|