C28H35N3O2S — CID 146231568
N-(4-butylphenyl)-3-[4-(2-methoxyphenyl)piperazin-1-yl]sulfinyl-4-methylaniline (PubChem CID 146231568) has the molecular formula C28H35N3O2S and a molecular weight of 477.67 g/mol. Its IUPAC name is N-(4-butylphenyl)-3-[4-(2-methoxyphenyl)piperazin-1-yl]sulfinyl-4-methylaniline.
| Compound Name | N-(4-butylphenyl)-3-[4-(2-methoxyphenyl)piperazin-1-yl]sulfinyl-4-methylaniline |
|---|---|
| PubChem CID | 146231568 |
| Molecular Formula | C28H35N3O2S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | N-(4-butylphenyl)-3-[4-(2-methoxyphenyl)piperazin-1-yl]sulfinyl-4-methylaniline |
| SMILES | CCCCc1ccc(Nc2ccc(C)c(S(=O)N3CCN(c4ccccc4OC)CC3)c2)cc1 |
| InChI | InChI=1S/C28H35N3O2S/c1-4-5-8-23-12-15-24(16-13-23)29-25-14-11-22(2)28(21-25)34(32)31-19-17-30(18-20-31)26-9-6-7-10-27(26)33-3/h6-7,9-16,21,29H,4-5,8,17-20H2,1-3H3 |
| InChIKey | JKKLTRXYISRLKS-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |