C16H41NO7P2+2 — CID 146237417
hydron;phosphono dihydrogen phosphate;tetrabutylazanium (PubChem CID 146237417) has the molecular formula C16H41NO7P2+2 and a molecular weight of 421.45 g/mol. Its IUPAC name is hydron;phosphono dihydrogen phosphate;tetrabutylazanium.
| Compound Name | hydron;phosphono dihydrogen phosphate;tetrabutylazanium |
|---|---|
| PubChem CID | 146237417 |
| Molecular Formula | C16H41NO7P2+2 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | hydron;phosphono dihydrogen phosphate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=P(O)(O)OP(=O)(O)O.[H+] |
| InChI | InChI=1S/C16H36N.H4O7P2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-8(2,3)7-9(4,5)6/h5-16H2,1-4H3;(H2,1,2,3)(H2,4,5,6)/q+1;/p+1 |
| InChIKey | IOFOEHXUKOLSKI-UHFFFAOYSA-O |
| XLogP | 4.30 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|