C28H28ClF2N5O4S — CID 146240373
ethyl 4-(2-chloro-3,4-difluorophenyl)-6-[2-(4-methoxy-4-oxobutyl)-4,5,6,7-tetrahydroindazol-5-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 146240373) has the molecular formula C28H28ClF2N5O4S and a molecular weight of 604.08 g/mol. Its IUPAC name is ethyl 4-(2-chloro-3,4-difluorophenyl)-6-[2-(4-methoxy-4-oxobutyl)-4,5,6,7-tetrahydroindazol-5-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(2-chloro-3,4-difluorophenyl)-6-[2-(4-methoxy-4-oxobutyl)-4,5,6,7-tetrahydroindazol-5-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 146240373 |
| Molecular Formula | C28H28ClF2N5O4S |
| Molecular Weight | 604.08 g/mol |
| Exact Mass | 603.15 |
| IUPAC Name | ethyl 4-(2-chloro-3,4-difluorophenyl)-6-[2-(4-methoxy-4-oxobutyl)-4,5,6,7-tetrahydroindazol-5-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C2CCc3nn(CCCC(=O)OC)cc3C2)NC(c2nccs2)=NC1c1ccc(F)c(F)c1Cl |
| InChI | InChI=1S/C28H28ClF2N5O4S/c1-3-40-28(38)21-24(15-6-9-19-16(13-15)14-36(35-19)11-4-5-20(37)39-2)33-26(27-32-10-12-41-27)34-25(21)17-7-8-18(30)23(31)22(17)29/h7-8,10,12,14-15,25H,3-6,9,11,13H2,1-2H3,(H,33,34) |
| InChIKey | ZBXKJSXQTFNTHX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.08 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|