C28H28ClF2N5O4S — CID 159093575
methane;methyl 4-(2-chloro-3,4-difluorophenyl)-6-[2-(3-methoxy-3-oxopropyl)-5,6,7,8-tetrahydroquinazolin-6-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 159093575) has the molecular formula C28H28ClF2N5O4S and a molecular weight of 604.08 g/mol. Its IUPAC name is methane;methyl 4-(2-chloro-3,4-difluorophenyl)-6-[2-(3-methoxy-3-oxopropyl)-5,6,7,8-tetrahydroquinazolin-6-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | methane;methyl 4-(2-chloro-3,4-difluorophenyl)-6-[2-(3-methoxy-3-oxopropyl)-5,6,7,8-tetrahydroquinazolin-6-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 159093575 |
| Molecular Formula | C28H28ClF2N5O4S |
| Molecular Weight | 604.08 g/mol |
| Exact Mass | 603.15 |
| IUPAC Name | methane;methyl 4-(2-chloro-3,4-difluorophenyl)-6-[2-(3-methoxy-3-oxopropyl)-5,6,7,8-tetrahydroquinazolin-6-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | C.COC(=O)CCc1ncc2c(n1)CCC(C1=C(C(=O)OC)C(c3ccc(F)c(F)c3Cl)N=C(c3nccs3)N1)C2 |
| InChI | InChI=1S/C27H24ClF2N5O4S.CH4/c1-38-19(36)8-7-18-32-12-14-11-13(3-6-17(14)33-18)23-20(27(37)39-2)24(15-4-5-16(29)22(30)21(15)28)35-25(34-23)26-31-9-10-40-26;/h4-5,9-10,12-13,24H,3,6-8,11H2,1-2H3,(H,34,35);1H4 |
| InChIKey | KCJJGEUFKJYOQT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.08 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|