C30H29ClF2N4O5S — CID 158440302
methyl 4-(2-chloro-3,4-difluorophenyl)-6-[2-(4-methoxycarbonylcyclohexyl)-4,5,6,7-tetrahydro-1,3-benzoxazol-6-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 158440302) has the molecular formula C30H29ClF2N4O5S and a molecular weight of 631.10 g/mol. Its IUPAC name is methyl 4-(2-chloro-3,4-difluorophenyl)-6-[2-(4-methoxycarbonylcyclohexyl)-4,5,6,7-tetrahydro-1,3-benzoxazol-6-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl 4-(2-chloro-3,4-difluorophenyl)-6-[2-(4-methoxycarbonylcyclohexyl)-4,5,6,7-tetrahydro-1,3-benzoxazol-6-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 158440302 |
| Molecular Formula | C30H29ClF2N4O5S |
| Molecular Weight | 631.10 g/mol |
| Exact Mass | 630.15 |
| IUPAC Name | methyl 4-(2-chloro-3,4-difluorophenyl)-6-[2-(4-methoxycarbonylcyclohexyl)-4,5,6,7-tetrahydro-1,3-benzoxazol-6-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C2CCc3nc(C4CCC(C(=O)OC)CC4)oc3C2)NC(c2nccs2)=NC1c1ccc(F)c(F)c1Cl |
| InChI | InChI=1S/C30H29ClF2N4O5S/c1-40-29(38)15-5-3-14(4-6-15)27-35-19-10-7-16(13-20(19)42-27)24-21(30(39)41-2)25(17-8-9-18(32)23(33)22(17)31)37-26(36-24)28-34-11-12-43-28/h8-9,11-12,14-16,25H,3-7,10,13H2,1-2H3,(H,36,37) |
| InChIKey | CDMYNXXCIXVNHA-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 115.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.10 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|