C27H28ClF2N5O4S — CID 160655887
ethyl 4-(2-chloro-3,4-difluorophenyl)-6-[2-(2-methoxy-2-oxoethyl)-4,5,6,7-tetrahydroindazol-5-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate;methane (PubChem CID 160655887) has the molecular formula C27H28ClF2N5O4S and a molecular weight of 592.07 g/mol. Its IUPAC name is ethyl 4-(2-chloro-3,4-difluorophenyl)-6-[2-(2-methoxy-2-oxoethyl)-4,5,6,7-tetrahydroindazol-5-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate;methane.
| Compound Name | ethyl 4-(2-chloro-3,4-difluorophenyl)-6-[2-(2-methoxy-2-oxoethyl)-4,5,6,7-tetrahydroindazol-5-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate;methane |
|---|---|
| PubChem CID | 160655887 |
| Molecular Formula | C27H28ClF2N5O4S |
| Molecular Weight | 592.07 g/mol |
| Exact Mass | 591.15 |
| IUPAC Name | ethyl 4-(2-chloro-3,4-difluorophenyl)-6-[2-(2-methoxy-2-oxoethyl)-4,5,6,7-tetrahydroindazol-5-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate;methane |
| SMILES | C.CCOC(=O)C1=C(C2CCc3nn(CC(=O)OC)cc3C2)NC(c2nccs2)=NC1c1ccc(F)c(F)c1Cl |
| InChI | InChI=1S/C26H24ClF2N5O4S.CH4/c1-3-38-26(36)19-22(13-4-7-17-14(10-13)11-34(33-17)12-18(35)37-2)31-24(25-30-8-9-39-25)32-23(19)15-5-6-16(28)21(29)20(15)27;/h5-6,8-9,11,13,23H,3-4,7,10,12H2,1-2H3,(H,31,32);1H4 |
| InChIKey | RLASNXHQOXCTAG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.07 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|