C17H21BrN4O4S — CID 146242984
5-bromo-1-[(4-methoxyphenyl)methyl]-3-(4-methylsulfonylpiperazin-1-yl)pyrazin-2-one (PubChem CID 146242984) has the molecular formula C17H21BrN4O4S and a molecular weight of 457.35 g/mol. Its IUPAC name is 5-bromo-1-[(4-methoxyphenyl)methyl]-3-(4-methylsulfonylpiperazin-1-yl)pyrazin-2-one.
| Compound Name | 5-bromo-1-[(4-methoxyphenyl)methyl]-3-(4-methylsulfonylpiperazin-1-yl)pyrazin-2-one |
|---|---|
| PubChem CID | 146242984 |
| Molecular Formula | C17H21BrN4O4S |
| Molecular Weight | 457.35 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 5-bromo-1-[(4-methoxyphenyl)methyl]-3-(4-methylsulfonylpiperazin-1-yl)pyrazin-2-one |
| SMILES | COc1ccc(Cn2cc(Br)nc(N3CCN(S(C)(=O)=O)CC3)c2=O)cc1 |
| InChI | InChI=1S/C17H21BrN4O4S/c1-26-14-5-3-13(4-6-14)11-21-12-15(18)19-16(17(21)23)20-7-9-22(10-8-20)27(2,24)25/h3-6,12H,7-11H2,1-2H3 |
| InChIKey | YAJGWXJFFYMFCV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |